C16H20N2O2S — CID 116630037
ethyl 1-methyl-5-[(3-methylphenyl)methylsulfanylmethyl]pyrazole-4-carboxylate (PubChem CID 116630037) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 1-methyl-5-[(3-methylphenyl)methylsulfanylmethyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[(3-methylphenyl)methylsulfanylmethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 116630037 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 1-methyl-5-[(3-methylphenyl)methylsulfanylmethyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CSCc1cccc(C)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-4-20-16(19)14-9-17-18(3)15(14)11-21-10-13-7-5-6-12(2)8-13/h5-9H,4,10-11H2,1-3H3 |
| InChIKey | UJAFYYDDUBULST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |