C14H24N4O2 — CID 116631025
5-[[(1-ethylpiperidin-4-yl)methylamino]methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116631025) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[[(1-ethylpiperidin-4-yl)methylamino]methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[[(1-ethylpiperidin-4-yl)methylamino]methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116631025 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 5-[[(1-ethylpiperidin-4-yl)methylamino]methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | CCN1CCC(CNCc2c(C(=O)O)cnn2C)CC1 |
| InChI | InChI=1S/C14H24N4O2/c1-3-18-6-4-11(5-7-18)8-15-10-13-12(14(19)20)9-16-17(13)2/h9,11,15H,3-8,10H2,1-2H3,(H,19,20) |
| InChIKey | GBNOAUXSYUYYCJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |