C15H25N3O2 — CID 116631047
ethyl 1-methyl-5-[[(1-methylcyclohexyl)amino]methyl]pyrazole-4-carboxylate (PubChem CID 116631047) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is ethyl 1-methyl-5-[[(1-methylcyclohexyl)amino]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[[(1-methylcyclohexyl)amino]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 116631047 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | ethyl 1-methyl-5-[[(1-methylcyclohexyl)amino]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CNC1(C)CCCCC1 |
| InChI | InChI=1S/C15H25N3O2/c1-4-20-14(19)12-10-17-18(3)13(12)11-16-15(2)8-6-5-7-9-15/h10,16H,4-9,11H2,1-3H3 |
| InChIKey | XCFKGAVTFTVVCT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |