C12H21N3O3 — CID 116631280
5-[[(1-methoxy-3-methylbutan-2-yl)amino]methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116631280) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[[(1-methoxy-3-methylbutan-2-yl)amino]methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[[(1-methoxy-3-methylbutan-2-yl)amino]methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116631280 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 5-[[(1-methoxy-3-methylbutan-2-yl)amino]methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | COCC(NCc1c(C(=O)O)cnn1C)C(C)C |
| InChI | InChI=1S/C12H21N3O3/c1-8(2)10(7-18-4)13-6-11-9(12(16)17)5-14-15(11)3/h5,8,10,13H,6-7H2,1-4H3,(H,16,17) |
| InChIKey | YLRWDCUQWLEAFO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |