C24H29FN4O4S — CID 11663145
N-[2-[7-[3-(4-cyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethyl]-3-fluorobenzenesulfonamide (PubChem CID 11663145) has the molecular formula C24H29FN4O4S and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[2-[7-[3-(4-cyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2-[7-[3-(4-cyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 11663145 |
| Molecular Formula | C24H29FN4O4S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[2-[7-[3-(4-cyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethyl]-3-fluorobenzenesulfonamide |
| SMILES | N#Cc1ccc(OCCCN2CC3CN(CCNS(=O)(=O)c4cccc(F)c4)CC(C2)O3)cc1 |
| InChI | InChI=1S/C24H29FN4O4S/c25-20-3-1-4-24(13-20)34(30,31)27-9-11-29-17-22-15-28(16-23(18-29)33-22)10-2-12-32-21-7-5-19(14-26)6-8-21/h1,3-8,13,22-23,27H,2,9-12,15-18H2 |
| InChIKey | PPZMYIBBRQRYND-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|