C12H23F3N2O — CID 116634245
[1-(3-amino-1,1,1-trifluoropentan-2-yl)azepan-2-yl]methanol (PubChem CID 116634245) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is [1-(3-amino-1,1,1-trifluoropentan-2-yl)azepan-2-yl]methanol.
| Compound Name | [1-(3-amino-1,1,1-trifluoropentan-2-yl)azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116634245 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [1-(3-amino-1,1,1-trifluoropentan-2-yl)azepan-2-yl]methanol |
| SMILES | CCC(N)C(N1CCCCCC1CO)C(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O/c1-2-10(16)11(12(13,14)15)17-7-5-3-4-6-9(17)8-18/h9-11,18H,2-8,16H2,1H3 |
| InChIKey | UMAIRFLGAQZLRN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |