C11H21F3N2O — CID 116634298
[1-(4-amino-1,1,1-trifluorobutan-2-yl)azepan-2-yl]methanol (PubChem CID 116634298) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is [1-(4-amino-1,1,1-trifluorobutan-2-yl)azepan-2-yl]methanol.
| Compound Name | [1-(4-amino-1,1,1-trifluorobutan-2-yl)azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116634298 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [1-(4-amino-1,1,1-trifluorobutan-2-yl)azepan-2-yl]methanol |
| SMILES | NCCC(N1CCCCCC1CO)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c12-11(13,14)10(5-6-15)16-7-3-1-2-4-9(16)8-17/h9-10,17H,1-8,15H2 |
| InChIKey | HHAORSFFVKLTRZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |