C11H22N2OS — CID 116634877
3-[2-(hydroxymethyl)azepan-1-yl]-2-methylpropanethioamide (PubChem CID 116634877) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)azepan-1-yl]-2-methylpropanethioamide.
| Compound Name | 3-[2-(hydroxymethyl)azepan-1-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 116634877 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-[2-(hydroxymethyl)azepan-1-yl]-2-methylpropanethioamide |
| SMILES | CC(CN1CCCCCC1CO)C(N)=S |
| InChI | InChI=1S/C11H22N2OS/c1-9(11(12)15)7-13-6-4-2-3-5-10(13)8-14/h9-10,14H,2-8H2,1H3,(H2,12,15) |
| InChIKey | UISLBYJOFISMPS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|