C28H30N6S2 — CID 11663526
2-methyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepine (PubChem CID 11663526) has the molecular formula C28H30N6S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is 2-methyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepine.
| Compound Name | 2-methyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 11663526 |
| Molecular Formula | C28H30N6S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-methyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepine |
| SMILES | Cc1ccc2c(-c3nnc(SCCCN4CCc5cc6nc(C)sc6cc5CC4)n3C)cccc2n1 |
| InChI | InChI=1S/C28H30N6S2/c1-18-8-9-22-23(6-4-7-24(22)29-18)27-31-32-28(33(27)3)35-15-5-12-34-13-10-20-16-25-26(36-19(2)30-25)17-21(20)11-14-34/h4,6-9,16-17H,5,10-15H2,1-3H3 |
| InChIKey | MXYJVPGKILUPBU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|