C24H29N5O2 — CID 11663540
(2S)-2,5-diamino-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide (PubChem CID 11663540) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is (2S)-2,5-diamino-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide.
| Compound Name | (2S)-2,5-diamino-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 11663540 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (2S)-2,5-diamino-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide |
| SMILES | NCCC[C@H](N)C(=O)N[C@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H29N5O2/c25-14-6-10-20(26)23(30)29-22(13-12-17-7-2-1-3-8-17)24(31)28-19-15-18-9-4-5-11-21(18)27-16-19/h1-5,7-9,11,15-16,20,22H,6,10,12-14,25-26H2,(H,28,31)(H,29,30)/t20-,22+/m0/s1 |
| InChIKey | KUXYCYLURMIFID-RBBKRZOGSA-N |
| XLogP | 2.36 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |