C26H30N8O2S — CID 11663578
2-(2,5-dimethylpyrazol-3-yl)-8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine (PubChem CID 11663578) has the molecular formula C26H30N8O2S and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)-8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)-8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine |
|---|---|
| PubChem CID | 11663578 |
| Molecular Formula | C26H30N8O2S |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)-8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine |
| SMILES | Cc1cc(-c2nc3c4c(ccc3o2)CCN(CCCSc2nnc(-c3ocnc3C)n2C)CC4)n(C)n1 |
| InChI | InChI=1S/C26H30N8O2S/c1-16-14-20(33(4)31-16)25-28-22-19-9-12-34(11-8-18(19)6-7-21(22)36-25)10-5-13-37-26-30-29-24(32(26)3)23-17(2)27-15-35-23/h6-7,14-15H,5,8-13H2,1-4H3 |
| InChIKey | KHTUQDQSUXMHQA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|