C13H19NO3 — CID 116636174
[2-(hydroxymethyl)azepan-1-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 116636174) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is [2-(hydroxymethyl)azepan-1-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [2-(hydroxymethyl)azepan-1-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 116636174 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | [2-(hydroxymethyl)azepan-1-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCCCCC1CO |
| InChI | InChI=1S/C13H19NO3/c1-10-6-8-17-12(10)13(16)14-7-4-2-3-5-11(14)9-15/h6,8,11,15H,2-5,7,9H2,1H3 |
| InChIKey | DGRKOTNFKJUMIN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |