C17H23NO3 — CID 116637206
(E)-3-[3-[[2-(hydroxymethyl)azepan-1-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 116637206) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-3-[3-[[2-(hydroxymethyl)azepan-1-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[2-(hydroxymethyl)azepan-1-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116637206 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (E)-3-[3-[[2-(hydroxymethyl)azepan-1-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(CN2CCCCCC2CO)c1 |
| InChI | InChI=1S/C17H23NO3/c19-13-16-7-2-1-3-10-18(16)12-15-6-4-5-14(11-15)8-9-17(20)21/h4-6,8-9,11,16,19H,1-3,7,10,12-13H2,(H,20,21)/b9-8+ |
| InChIKey | WHFOHZZRYMPGHI-CMDGGOBGSA-N |
| XLogP | 2.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|