C26H35N5 — CID 11663744
4-[3-(4-benzylpiperazin-1-yl)propyl]-6-cycloheptylpyrimidine-2-carbonitrile (PubChem CID 11663744) has the molecular formula C26H35N5 and a molecular weight of 417.60 g/mol. Its IUPAC name is 4-[3-(4-benzylpiperazin-1-yl)propyl]-6-cycloheptylpyrimidine-2-carbonitrile.
| Compound Name | 4-[3-(4-benzylpiperazin-1-yl)propyl]-6-cycloheptylpyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 11663744 |
| Molecular Formula | C26H35N5 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 4-[3-(4-benzylpiperazin-1-yl)propyl]-6-cycloheptylpyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(CCCN2CCN(Cc3ccccc3)CC2)cc(C2CCCCCC2)n1 |
| InChI | InChI=1S/C26H35N5/c27-20-26-28-24(19-25(29-26)23-11-6-1-2-7-12-23)13-8-14-30-15-17-31(18-16-30)21-22-9-4-3-5-10-22/h3-5,9-10,19,23H,1-2,6-8,11-18,21H2 |
| InChIKey | RVCKBRONBZXNIH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |