C13H23NO3 — CID 116638064
3-[[2-(hydroxymethyl)azepan-1-yl]methyl]oxolane-3-carbaldehyde (PubChem CID 116638064) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-[[2-(hydroxymethyl)azepan-1-yl]methyl]oxolane-3-carbaldehyde.
| Compound Name | 3-[[2-(hydroxymethyl)azepan-1-yl]methyl]oxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 116638064 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 3-[[2-(hydroxymethyl)azepan-1-yl]methyl]oxolane-3-carbaldehyde |
| SMILES | O=CC1(CN2CCCCCC2CO)CCOC1 |
| InChI | InChI=1S/C13H23NO3/c15-8-12-4-2-1-3-6-14(12)9-13(10-16)5-7-17-11-13/h10,12,15H,1-9,11H2 |
| InChIKey | OEEVXRIWRCTCBH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|