C12H20BrN3 — CID 116638341
2-(bromomethyl)-1-[(1-methylpyrazol-3-yl)methyl]azepane (PubChem CID 116638341) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(1-methylpyrazol-3-yl)methyl]azepane.
| Compound Name | 2-(bromomethyl)-1-[(1-methylpyrazol-3-yl)methyl]azepane |
|---|---|
| PubChem CID | 116638341 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(bromomethyl)-1-[(1-methylpyrazol-3-yl)methyl]azepane |
| SMILES | Cn1ccc(CN2CCCCCC2CBr)n1 |
| InChI | InChI=1S/C12H20BrN3/c1-15-8-6-11(14-15)10-16-7-4-2-3-5-12(16)9-13/h6,8,12H,2-5,7,9-10H2,1H3 |
| InChIKey | DLTROPVCHCRVCU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|