C16H21BrClNO — CID 116638420
2-(bromomethyl)-1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]azepane (PubChem CID 116638420) has the molecular formula C16H21BrClNO and a molecular weight of 358.71 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]azepane.
| Compound Name | 2-(bromomethyl)-1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]azepane |
|---|---|
| PubChem CID | 116638420 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-(bromomethyl)-1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]azepane |
| SMILES | Clc1cc2c(c(CN3CCCCCC3CBr)c1)OCC2 |
| InChI | InChI=1S/C16H21BrClNO/c17-10-15-4-2-1-3-6-19(15)11-13-9-14(18)8-12-5-7-20-16(12)13/h8-9,15H,1-7,10-11H2 |
| InChIKey | RRYYOVWKMMFZJR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|