C16H24ClNO2 — CID 116638601
2-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]azepane (PubChem CID 116638601) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]azepane.
| Compound Name | 2-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]azepane |
|---|---|
| PubChem CID | 116638601 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(chloromethyl)-1-[(3,4-dimethoxyphenyl)methyl]azepane |
| SMILES | COc1ccc(CN2CCCCCC2CCl)cc1OC |
| InChI | InChI=1S/C16H24ClNO2/c1-19-15-8-7-13(10-16(15)20-2)12-18-9-5-3-4-6-14(18)11-17/h7-8,10,14H,3-6,9,11-12H2,1-2H3 |
| InChIKey | VNDNDICLHDPZBA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|