About 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane
2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane (PubChem CID 116638676) has the molecular formula C11H19ClF3NO
and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane |
| PubChem CID | 116638676 |
| Molecular Formula | C11H19ClF3NO |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane |
| SMILES | FC(F)(F)COCCN1CCCCCC1CCl |
| InChI | InChI=1S/C11H19ClF3NO/c12-8-10-4-2-1-3-5-16(10)6-7-17-9-11(13,14)15/h10H,1-9H2 |
| InChIKey | UPQJHLKJYNQMAH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The IUPAC name of 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane (CID 116638676) is 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane.
What is the SMILES notation for 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The canonical SMILES for 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane is FC(F)(F)COCCN1CCCCCC1CCl.
What is the InChIKey of 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
The InChIKey is UPQJHLKJYNQMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClF3NO/c12-8-10-4-2-1-3-5-16(10)6-7-17-9-11(13,14)15/h10H,1-9H2.
What are the key properties of 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane?
2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane has a molecular weight of 273.73 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]azepane is sourced from PubChem (CID 116638676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).