C12H15Br2ClN2 — CID 116638871
2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane (PubChem CID 116638871) has the molecular formula C12H15Br2ClN2 and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane.
| Compound Name | 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane |
|---|---|
| PubChem CID | 116638871 |
| Molecular Formula | C12H15Br2ClN2 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane |
| SMILES | ClCC1CCCCCN1c1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br2ClN2/c13-9-6-11(14)12(16-8-9)17-5-3-1-2-4-10(17)7-15/h6,8,10H,1-5,7H2 |
| InChIKey | RPZOYAKNLZNEKP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|