About 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane
2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane (PubChem CID 116638871) has the molecular formula C12H15Br2ClN2
and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane |
| PubChem CID | 116638871 |
| Molecular Formula | C12H15Br2ClN2 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane |
| SMILES | ClCC1CCCCCN1c1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br2ClN2/c13-9-6-11(14)12(16-8-9)17-5-3-1-2-4-10(17)7-15/h6,8,10H,1-5,7H2 |
| InChIKey | RPZOYAKNLZNEKP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane?
The IUPAC name of 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane (CID 116638871) is 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane.
What is the SMILES notation for 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane?
The canonical SMILES for 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane is ClCC1CCCCCN1c1ncc(Br)cc1Br.
What is the InChIKey of 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane?
The InChIKey is RPZOYAKNLZNEKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Br2ClN2/c13-9-6-11(14)12(16-8-9)17-5-3-1-2-4-10(17)7-15/h6,8,10H,1-5,7H2.
What are the key properties of 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane?
2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane has a molecular weight of 382.53 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1-(3,5-dibromo-2-pyridinyl)azepane is sourced from PubChem (CID 116638871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).