C18H21Cl3N2O11 — CID 11663955
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxomorpholin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11663955) has the molecular formula C18H21Cl3N2O11 and a molecular weight of 547.73 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxomorpholin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxomorpholin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11663955 |
| Molecular Formula | C18H21Cl3N2O11 |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxomorpholin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1N1C(=O)COCC1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H21Cl3N2O11/c1-7(24)30-4-10-14(31-8(2)25)15(32-9(3)26)13(23-11(27)5-29-6-12(23)28)16(33-10)34-17(22)18(19,20)21/h10,13-16,22H,4-6H2,1-3H3/b22-17+/t10-,13-,14-,15-,16+/m1/s1 |
| InChIKey | SPSQHIDQXPENOI-ZMOSSBAESA-N |
| XLogP | 0.26 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|