C32H37N7S — CID 11663999
7-(2,5-dimethylpyrazol-3-yl)-3-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butan-2-yl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 11663999) has the molecular formula C32H37N7S and a molecular weight of 551.76 g/mol. Its IUPAC name is 7-(2,5-dimethylpyrazol-3-yl)-3-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butan-2-yl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-(2,5-dimethylpyrazol-3-yl)-3-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butan-2-yl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 11663999 |
| Molecular Formula | C32H37N7S |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 7-(2,5-dimethylpyrazol-3-yl)-3-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butan-2-yl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | Cc1ccc2c(-c3nnc(SCCC(C)N4CCc5ccc(-c6cc(C)nn6C)cc5CC4)n3C)cccc2n1 |
| InChI | InChI=1S/C32H37N7S/c1-21-9-12-27-28(7-6-8-29(27)33-21)31-34-35-32(37(31)4)40-18-15-23(3)39-16-13-24-10-11-26(20-25(24)14-17-39)30-19-22(2)36-38(30)5/h6-12,19-20,23H,13-18H2,1-5H3 |
| InChIKey | BZIIORPIORBBJU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |