C14H26N2 — CID 116641100
1-(aminomethyl)-N-but-3-ynyl-4,4-dimethylcycloheptan-1-amine (PubChem CID 116641100) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-(aminomethyl)-N-but-3-ynyl-4,4-dimethylcycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-N-but-3-ynyl-4,4-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 116641100 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-(aminomethyl)-N-but-3-ynyl-4,4-dimethylcycloheptan-1-amine |
| SMILES | C#CCCNC1(CN)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C14H26N2/c1-4-5-11-16-14(12-15)8-6-7-13(2,3)9-10-14/h1,16H,5-12,15H2,2-3H3 |
| InChIKey | UIOXTGKVZHSLAG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|