C11H19F3N2 — CID 116641311
2-N-but-3-ynyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine (PubChem CID 116641311) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-N-but-3-ynyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine.
| Compound Name | 2-N-but-3-ynyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 116641311 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-N-but-3-ynyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
| SMILES | C#CCCNC(C)(CN)CCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2/c1-3-4-8-16-10(2,9-15)6-5-7-11(12,13)14/h1,16H,4-9,15H2,2H3 |
| InChIKey | LSRBZPLSFSYJQP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|