About 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine
2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine (PubChem CID 116642403) has the molecular formula C12H10F4N2O
and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine |
| PubChem CID | 116642403 |
| Molecular Formula | C12H10F4N2O |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine |
| SMILES | NCCc1cc(-c2ccc(F)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C12H10F4N2O/c13-10-2-1-7(5-9(10)12(14,15)16)11-6-8(3-4-17)19-18-11/h1-2,5-6H,3-4,17H2 |
| InChIKey | MVPJNPFBBKANFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine?
The IUPAC name of 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine (CID 116642403) is 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine.
What is the SMILES notation for 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine?
The canonical SMILES for 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine is NCCc1cc(-c2ccc(F)c(C(F)(F)F)c2)no1.
What is the InChIKey of 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine?
The InChIKey is MVPJNPFBBKANFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F4N2O/c13-10-2-1-7(5-9(10)12(14,15)16)11-6-8(3-4-17)19-18-11/h1-2,5-6H,3-4,17H2.
What are the key properties of 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine?
2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine has a molecular weight of 274.22 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]ethanamine is sourced from PubChem (CID 116642403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).