C10H14N4O — CID 116642593
2-(3-aminopyrazol-1-yl)-N-pent-3-ynylacetamide (PubChem CID 116642593) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-pent-3-ynylacetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-pent-3-ynylacetamide |
|---|---|
| PubChem CID | 116642593 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-pent-3-ynylacetamide |
| SMILES | CC#CCCNC(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C10H14N4O/c1-2-3-4-6-12-10(15)8-14-7-5-9(11)13-14/h5,7H,4,6,8H2,1H3,(H2,11,13)(H,12,15) |
| InChIKey | AVGUHDYQRZXQIH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|