C28H23ClF6N2O4 — CID 11664390
(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-(2-chloro-5-propan-2-ylphenyl)-5-nitrophenyl]methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 11664390) has the molecular formula C28H23ClF6N2O4 and a molecular weight of 600.94 g/mol. Its IUPAC name is (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-(2-chloro-5-propan-2-ylphenyl)-5-nitrophenyl]methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-(2-chloro-5-propan-2-ylphenyl)-5-nitrophenyl]methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11664390 |
| Molecular Formula | C28H23ClF6N2O4 |
| Molecular Weight | 600.94 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-(2-chloro-5-propan-2-ylphenyl)-5-nitrophenyl]methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)c1ccc(Cl)c(-c2ccc([N+](=O)[O-])cc2CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)c1 |
| InChI | InChI=1S/C28H23ClF6N2O4/c1-14(2)16-4-7-24(29)23(11-16)22-6-5-21(37(39)40)10-18(22)13-36-15(3)25(41-26(36)38)17-8-19(27(30,31)32)12-20(9-17)28(33,34)35/h4-12,14-15,25H,13H2,1-3H3/t15-,25-/m0/s1 |
| InChIKey | PNEOYBOCZNVWNT-MQNRADLISA-N |
| XLogP | 9.16 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.94 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|