About 1-pent-3-ynylpyrrole-2,5-dione
1-pent-3-ynylpyrrole-2,5-dione (PubChem CID 116644372) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-pent-3-ynylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-pent-3-ynylpyrrole-2,5-dione |
| PubChem CID | 116644372 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-pent-3-ynylpyrrole-2,5-dione |
| SMILES | CC#CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H9NO2/c1-2-3-4-7-10-8(11)5-6-9(10)12/h5-6H,4,7H2,1H3 |
| InChIKey | ZGZINSPXWMXDIM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pent-3-ynylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pent-3-ynylpyrrole-2,5-dione?
The IUPAC name of 1-pent-3-ynylpyrrole-2,5-dione (CID 116644372) is 1-pent-3-ynylpyrrole-2,5-dione.
What is the SMILES notation for 1-pent-3-ynylpyrrole-2,5-dione?
The canonical SMILES for 1-pent-3-ynylpyrrole-2,5-dione is CC#CCCN1C(=O)C=CC1=O.
What is the InChIKey of 1-pent-3-ynylpyrrole-2,5-dione?
The InChIKey is ZGZINSPXWMXDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-3-4-7-10-8(11)5-6-9(10)12/h5-6H,4,7H2,1H3.
What are the key properties of 1-pent-3-ynylpyrrole-2,5-dione?
1-pent-3-ynylpyrrole-2,5-dione has a molecular weight of 163.18 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pent-3-ynylpyrrole-2,5-dione is sourced from PubChem (CID 116644372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).