C10H19N5O3S — CID 116646497
1-(3-amino-1-ethylpyrazol-4-yl)sulfonyl-3-tert-butylurea (PubChem CID 116646497) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(3-amino-1-ethylpyrazol-4-yl)sulfonyl-3-tert-butylurea.
| Compound Name | 1-(3-amino-1-ethylpyrazol-4-yl)sulfonyl-3-tert-butylurea |
|---|---|
| PubChem CID | 116646497 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-(3-amino-1-ethylpyrazol-4-yl)sulfonyl-3-tert-butylurea |
| SMILES | CCn1cc(S(=O)(=O)NC(=O)NC(C)(C)C)c(N)n1 |
| InChI | InChI=1S/C10H19N5O3S/c1-5-15-6-7(8(11)13-15)19(17,18)14-9(16)12-10(2,3)4/h6H,5H2,1-4H3,(H2,11,13)(H2,12,14,16) |
| InChIKey | XVNMPDXURZQKRG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |