About 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile
4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile (PubChem CID 116646992) has the molecular formula C8H7F3N4
and a molecular weight of 216.17 g/mol. Its IUPAC name is 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile |
| PubChem CID | 116646992 |
| Molecular Formula | C8H7F3N4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile |
| SMILES | Cc1nc(CC(F)(F)F)nc(N)c1C#N |
| InChI | InChI=1S/C8H7F3N4/c1-4-5(3-12)7(13)15-6(14-4)2-8(9,10)11/h2H2,1H3,(H2,13,14,15) |
| InChIKey | BXIIFYJEJMZQEZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile (CID 116646992) is 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile is Cc1nc(CC(F)(F)F)nc(N)c1C#N.
What is the InChIKey of 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile?
The InChIKey is BXIIFYJEJMZQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N4/c1-4-5(3-12)7(13)15-6(14-4)2-8(9,10)11/h2H2,1H3,(H2,13,14,15).
What are the key properties of 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile?
4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile has a molecular weight of 216.17 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-methyl-2-(2,2,2-trifluoroethyl)pyrimidine-5-carbonitrile is sourced from PubChem (CID 116646992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).