C32H35Cl3N4O5S — CID 11664774
(1R,5S)-N-[(2-chloro-3,5-dimethoxyphenyl)methyl]-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 11664774) has the molecular formula C32H35Cl3N4O5S and a molecular weight of 694.08 g/mol. Its IUPAC name is (1R,5S)-N-[(2-chloro-3,5-dimethoxyphenyl)methyl]-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (1R,5S)-N-[(2-chloro-3,5-dimethoxyphenyl)methyl]-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 11664774 |
| Molecular Formula | C32H35Cl3N4O5S |
| Molecular Weight | 694.08 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | (1R,5S)-N-[(2-chloro-3,5-dimethoxyphenyl)methyl]-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | COc1cc(CN(C(=O)C2=C(c3cnc(OCCOc4c(Cl)cc(C)cc4Cl)s3)C[C@@H]3CNC[C@H]2N3)C2CC2)c(Cl)c(OC)c1 |
| InChI | InChI=1S/C32H35Cl3N4O5S/c1-17-8-23(33)30(24(34)9-17)43-6-7-44-32-37-15-27(45-32)22-11-19-13-36-14-25(38-19)28(22)31(40)39(20-4-5-20)16-18-10-21(41-2)12-26(42-3)29(18)35/h8-10,12,15,19-20,25,36,38H,4-7,11,13-14,16H2,1-3H3/t19-,25-/m1/s1 |
| InChIKey | XFDSASSXXCFJAP-KBMIEXCESA-N |
| XLogP | 6.17 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.08 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|