C10H15IN4 — CID 116648605
1-(5-iodopyrimidin-2-yl)-4-methylpiperidin-3-amine (PubChem CID 116648605) has the molecular formula C10H15IN4 and a molecular weight of 318.16 g/mol. Its IUPAC name is 1-(5-iodopyrimidin-2-yl)-4-methylpiperidin-3-amine.
| Compound Name | 1-(5-iodopyrimidin-2-yl)-4-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 116648605 |
| Molecular Formula | C10H15IN4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(5-iodopyrimidin-2-yl)-4-methylpiperidin-3-amine |
| SMILES | CC1CCN(c2ncc(I)cn2)CC1N |
| InChI | InChI=1S/C10H15IN4/c1-7-2-3-15(6-9(7)12)10-13-4-8(11)5-14-10/h4-5,7,9H,2-3,6,12H2,1H3 |
| InChIKey | UNGIMXVKKWOGDP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|