C9H13IN4 — CID 116648669
1-cyclopropyl-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 116648669) has the molecular formula C9H13IN4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 1-cyclopropyl-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116648669 |
| Molecular Formula | C9H13IN4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 1-cyclopropyl-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | NC(CNc1ncc(I)cn1)C1CC1 |
| InChI | InChI=1S/C9H13IN4/c10-7-3-12-9(13-4-7)14-5-8(11)6-1-2-6/h3-4,6,8H,1-2,5,11H2,(H,12,13,14) |
| InChIKey | XCYCETRHVNXIFS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|