C11H17IN4 — CID 116649014
5-iodo-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrimidin-2-amine (PubChem CID 116649014) has the molecular formula C11H17IN4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 5-iodo-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrimidin-2-amine.
| Compound Name | 5-iodo-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 116649014 |
| Molecular Formula | C11H17IN4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-iodo-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrimidin-2-amine |
| SMILES | CN(CC1CCCN1C)c1ncc(I)cn1 |
| InChI | InChI=1S/C11H17IN4/c1-15-5-3-4-10(15)8-16(2)11-13-6-9(12)7-14-11/h6-7,10H,3-5,8H2,1-2H3 |
| InChIKey | HNSWGGRBVXRUIQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|