C14H16N2 — CID 116650626
5-pyrrol-1-yl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 116650626) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-pyrrol-1-yl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | 5-pyrrol-1-yl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 116650626 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-pyrrol-1-yl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | Nc1ccc2c(c1)CCCC2n1cccc1 |
| InChI | InChI=1S/C14H16N2/c15-12-6-7-13-11(10-12)4-3-5-14(13)16-8-1-2-9-16/h1-2,6-10,14H,3-5,15H2 |
| InChIKey | OJSGPQKNFQIKOC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|