C15H23N3O3 — CID 116653510
1-cyclopropyl-N-methyl-N-(3-nitro-5-propoxyphenyl)ethane-1,2-diamine (PubChem CID 116653510) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-cyclopropyl-N-methyl-N-(3-nitro-5-propoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-methyl-N-(3-nitro-5-propoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116653510 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-cyclopropyl-N-methyl-N-(3-nitro-5-propoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCOc1cc(N(C)C(CN)C2CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H23N3O3/c1-3-6-21-14-8-12(7-13(9-14)18(19)20)17(2)15(10-16)11-4-5-11/h7-9,11,15H,3-6,10,16H2,1-2H3 |
| InChIKey | RHHJSWKRHAEVNE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|