C7H10N4O — CID 116653848
1,1-bis(cyanomethyl)-3,3-dimethylurea (PubChem CID 116653848) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,1-bis(cyanomethyl)-3,3-dimethylurea.
| Compound Name | 1,1-bis(cyanomethyl)-3,3-dimethylurea |
|---|---|
| PubChem CID | 116653848 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1,1-bis(cyanomethyl)-3,3-dimethylurea |
| SMILES | CN(C)C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C7H10N4O/c1-10(2)7(12)11(5-3-8)6-4-9/h5-6H2,1-2H3 |
| InChIKey | SJEFYPIHHDEQLH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|