About 1,1-bis(cyanomethyl)-3,3-dimethylurea
1,1-bis(cyanomethyl)-3,3-dimethylurea (PubChem CID 116653848) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,1-bis(cyanomethyl)-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1,1-bis(cyanomethyl)-3,3-dimethylurea |
| PubChem CID | 116653848 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1,1-bis(cyanomethyl)-3,3-dimethylurea |
| SMILES | CN(C)C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C7H10N4O/c1-10(2)7(12)11(5-3-8)6-4-9/h5-6H2,1-2H3 |
| InChIKey | SJEFYPIHHDEQLH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(cyanomethyl)-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(cyanomethyl)-3,3-dimethylurea?
The IUPAC name of 1,1-bis(cyanomethyl)-3,3-dimethylurea (CID 116653848) is 1,1-bis(cyanomethyl)-3,3-dimethylurea.
What is the SMILES notation for 1,1-bis(cyanomethyl)-3,3-dimethylurea?
The canonical SMILES for 1,1-bis(cyanomethyl)-3,3-dimethylurea is CN(C)C(=O)N(CC#N)CC#N.
What is the InChIKey of 1,1-bis(cyanomethyl)-3,3-dimethylurea?
The InChIKey is SJEFYPIHHDEQLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-10(2)7(12)11(5-3-8)6-4-9/h5-6H2,1-2H3.
What are the key properties of 1,1-bis(cyanomethyl)-3,3-dimethylurea?
1,1-bis(cyanomethyl)-3,3-dimethylurea has a molecular weight of 166.18 g/mol, XLogP of 0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(cyanomethyl)-3,3-dimethylurea is sourced from PubChem (CID 116653848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).