About 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea
1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 116654413) has the molecular formula C7H13F3N2O
and a molecular weight of 198.19 g/mol. Its IUPAC name is 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 116654413 |
| Molecular Formula | C7H13F3N2O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(C)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O/c1-4-11(2)6(13)12(3)5-7(8,9)10/h4-5H2,1-3H3 |
| InChIKey | XERCOAZCUSDYRX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea (CID 116654413) is 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea is CCN(C)C(=O)N(C)CC(F)(F)F.
What is the InChIKey of 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is XERCOAZCUSDYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O/c1-4-11(2)6(13)12(3)5-7(8,9)10/h4-5H2,1-3H3.
What are the key properties of 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea?
1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 198.19 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,3-dimethyl-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 116654413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).