About 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine
1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine (PubChem CID 11665451) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine.
Analyze 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine?
The IUPAC name of 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine (CID 11665451) is 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine.
What is the SMILES notation for 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine?
The canonical SMILES for 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine is CSC1=CCCCCN1C.
What is the InChIKey of 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine?
The InChIKey is ZCDCAJNQYGAMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-9-7-5-3-4-6-8(9)10-2/h6H,3-5,7H2,1-2H3.
What are the key properties of 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine?
1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine has a molecular weight of 157.28 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-methylsulfanyl-2,3,4,5-tetrahydroazepine is sourced from PubChem (CID 11665451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).