C10H16N2O2S — CID 116654722
propan-2-yl N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamate (PubChem CID 116654722) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is propan-2-yl N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamate.
| Compound Name | propan-2-yl N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 116654722 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | propan-2-yl N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCc1nc(NC(=O)OC(C)C)sc1C |
| InChI | InChI=1S/C10H16N2O2S/c1-5-8-7(4)15-9(11-8)12-10(13)14-6(2)3/h6H,5H2,1-4H3,(H,11,12,13) |
| InChIKey | SHCRUNQPYDVUHY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |