About methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate
methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate (PubChem CID 11665473) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate |
| PubChem CID | 11665473 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC=CC(=O)N1 |
| InChI | InChI=1S/C8H11NO3/c1-12-8(11)5-6-3-2-4-7(10)9-6/h2,4,6H,3,5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | UZRUYXGAEFFZPI-LURJTMIESA-N |
| XLogP | -0.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate?
The IUPAC name of methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate (CID 11665473) is methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate?
The canonical SMILES for methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate is COC(=O)C[C@@H]1CC=CC(=O)N1.
What is the InChIKey of methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate?
The InChIKey is UZRUYXGAEFFZPI-LURJTMIESA-N. The full InChI is InChI=1S/C8H11NO3/c1-12-8(11)5-6-3-2-4-7(10)9-6/h2,4,6H,3,5H2,1H3,(H,9,10)/t6-/m0/s1.
What are the key properties of methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate?
methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate has a molecular weight of 169.18 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]acetate is sourced from PubChem (CID 11665473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).