About 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea
3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 116655116) has the molecular formula C11H17F3N2O
and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 116655116 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NC1CCCC1)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H17F3N2O/c12-11(13,14)7-16(9-5-6-9)10(17)15-8-3-1-2-4-8/h8-9H,1-7H2,(H,15,17) |
| InChIKey | UTUDFIFRWYMTEX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea (CID 116655116) is 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea is O=C(NC1CCCC1)N(CC(F)(F)F)C1CC1.
What is the InChIKey of 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea?
The InChIKey is UTUDFIFRWYMTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O/c12-11(13,14)7-16(9-5-6-9)10(17)15-8-3-1-2-4-8/h8-9H,1-7H2,(H,15,17).
What are the key properties of 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea?
3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea has a molecular weight of 250.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 116655116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).