C17H24N2O — CID 116656264
azepan-1-yl(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone (PubChem CID 116656264) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is azepan-1-yl(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone.
| Compound Name | azepan-1-yl(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone |
|---|---|
| PubChem CID | 116656264 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | azepan-1-yl(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone |
| SMILES | O=C(N1CCCCCC1)N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C17H24N2O/c20-17(18-11-5-1-2-6-12-18)19-13-9-15-7-3-4-8-16(15)10-14-19/h3-4,7-8H,1-2,5-6,9-14H2 |
| InChIKey | KMXFAUUITYSPLV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |