C14H23NO — CID 11665730
N-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclopropanecarboxamide (PubChem CID 11665730) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclopropanecarboxamide.
| Compound Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 11665730 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]cyclopropanecarboxamide |
| SMILES | CC(C)=CCC/C(C)=C\CNC(=O)C1CC1 |
| InChI | InChI=1S/C14H23NO/c1-11(2)5-4-6-12(3)9-10-15-14(16)13-7-8-13/h5,9,13H,4,6-8,10H2,1-3H3,(H,15,16)/b12-9- |
| InChIKey | UKNMSFRSBQONET-XFXZXTDPSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|