C10H17N3O2 — CID 116657682
N-cyclopropyl-2-(cyclopropylcarbamoylamino)propanamide (PubChem CID 116657682) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-cyclopropyl-2-(cyclopropylcarbamoylamino)propanamide.
| Compound Name | N-cyclopropyl-2-(cyclopropylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 116657682 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-cyclopropyl-2-(cyclopropylcarbamoylamino)propanamide |
| SMILES | CC(NC(=O)NC1CC1)C(=O)NC1CC1 |
| InChI | InChI=1S/C10H17N3O2/c1-6(9(14)12-7-2-3-7)11-10(15)13-8-4-5-8/h6-8H,2-5H2,1H3,(H,12,14)(H2,11,13,15) |
| InChIKey | DOXYNLQOGBUXSG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |