C10H15N3O2 — CID 116658004
N-(4-methyl-1,3-oxazol-2-yl)piperidine-1-carboxamide (PubChem CID 116658004) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(4-methyl-1,3-oxazol-2-yl)piperidine-1-carboxamide.
| Compound Name | N-(4-methyl-1,3-oxazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 116658004 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(4-methyl-1,3-oxazol-2-yl)piperidine-1-carboxamide |
| SMILES | Cc1coc(NC(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C10H15N3O2/c1-8-7-15-9(11-8)12-10(14)13-5-3-2-4-6-13/h7H,2-6H2,1H3,(H,11,12,14) |
| InChIKey | NSALWKLDTPHEML-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |