C15H10N2O — CID 11665831
14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 11665831) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is 14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 11665831 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | Cn1nc2c3c(cccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C15H10N2O/c1-17-12-8-4-7-11-13(12)14(16-17)9-5-2-3-6-10(9)15(11)18/h2-8H,1H3 |
| InChIKey | ODZGYELAMAOARP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |