C16H20N2O2 — CID 116658753
1-cyclobutyl-3-[1-[3-(3-hydroxyprop-1-ynyl)phenyl]ethyl]urea (PubChem CID 116658753) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-cyclobutyl-3-[1-[3-(3-hydroxyprop-1-ynyl)phenyl]ethyl]urea.
| Compound Name | 1-cyclobutyl-3-[1-[3-(3-hydroxyprop-1-ynyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 116658753 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-cyclobutyl-3-[1-[3-(3-hydroxyprop-1-ynyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NC1CCC1)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-12(17-16(20)18-15-8-3-9-15)14-7-2-5-13(11-14)6-4-10-19/h2,5,7,11-12,15,19H,3,8-10H2,1H3,(H2,17,18,20) |
| InChIKey | AQCTXWOAQQEGNT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|