C8H15F2NO3S — CID 11665924
(3S)-3-amino-3-cyclopentyl-2,2-difluoropropane-1-sulfonic acid (PubChem CID 11665924) has the molecular formula C8H15F2NO3S and a molecular weight of 243.27 g/mol. Its IUPAC name is (3S)-3-amino-3-cyclopentyl-2,2-difluoropropane-1-sulfonic acid.
| Compound Name | (3S)-3-amino-3-cyclopentyl-2,2-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 11665924 |
| Molecular Formula | C8H15F2NO3S |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3S)-3-amino-3-cyclopentyl-2,2-difluoropropane-1-sulfonic acid |
| SMILES | N[C@@H](C1CCCC1)C(F)(F)CS(=O)(=O)O |
| InChI | InChI=1S/C8H15F2NO3S/c9-8(10,5-15(12,13)14)7(11)6-3-1-2-4-6/h6-7H,1-5,11H2,(H,12,13,14)/t7-/m0/s1 |
| InChIKey | FXQQXSHSVOZBNQ-ZETCQYMHSA-N |
| XLogP | 1.03 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|