C16H20O2 — CID 11665939
(5'-methylidenespiro[2,3-dihydro-1H-naphthalene-4,2'-oxane]-4'-yl)methanol (PubChem CID 11665939) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (5'-methylidenespiro[2,3-dihydro-1H-naphthalene-4,2'-oxane]-4'-yl)methanol.
| Compound Name | (5'-methylidenespiro[2,3-dihydro-1H-naphthalene-4,2'-oxane]-4'-yl)methanol |
|---|---|
| PubChem CID | 11665939 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (5'-methylidenespiro[2,3-dihydro-1H-naphthalene-4,2'-oxane]-4'-yl)methanol |
| SMILES | C=C1COC2(CCCc3ccccc32)CC1CO |
| InChI | InChI=1S/C16H20O2/c1-12-11-18-16(9-14(12)10-17)8-4-6-13-5-2-3-7-15(13)16/h2-3,5,7,14,17H,1,4,6,8-11H2 |
| InChIKey | WXHMDBLGWCUCNK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|